C13H20NO6P — CID 53387869
[3-[acetyl(hydroxy)amino]-1-[2-(methoxymethyl)phenyl]propyl]phosphonic acid (PubChem CID 53387869) has the molecular formula C13H20NO6P and a molecular weight of 317.28 g/mol. Its IUPAC name is [3-[acetyl(hydroxy)amino]-1-[2-(methoxymethyl)phenyl]propyl]phosphonic acid.
| Compound Name | [3-[acetyl(hydroxy)amino]-1-[2-(methoxymethyl)phenyl]propyl]phosphonic acid |
|---|---|
| PubChem CID | 53387869 |
| Molecular Formula | C13H20NO6P |
| Molecular Weight | 317.28 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | [3-[acetyl(hydroxy)amino]-1-[2-(methoxymethyl)phenyl]propyl]phosphonic acid |
| SMILES | COCc1ccccc1C(CCN(O)C(C)=O)P(=O)(O)O |
| InChI | InChI=1S/C13H20NO6P/c1-10(15)14(16)8-7-13(21(17,18)19)12-6-4-3-5-11(12)9-20-2/h3-6,13,16H,7-9H2,1-2H3,(H2,17,18,19) |
| InChIKey | NMDNXJBYPYZXRY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|