C8H18N3O3P — CID 25127996
[3-(dimethylamino)-1-(ethyliminomethylideneamino)propyl]phosphonic acid (PubChem CID 25127996) has the molecular formula C8H18N3O3P and a molecular weight of 235.22 g/mol. Its IUPAC name is [3-(dimethylamino)-1-(ethyliminomethylideneamino)propyl]phosphonic acid.
| Compound Name | [3-(dimethylamino)-1-(ethyliminomethylideneamino)propyl]phosphonic acid |
|---|---|
| PubChem CID | 25127996 |
| Molecular Formula | C8H18N3O3P |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | [3-(dimethylamino)-1-(ethyliminomethylideneamino)propyl]phosphonic acid |
| SMILES | CCN=C=NC(CCN(C)C)P(=O)(O)O |
| InChI | InChI=1S/C8H18N3O3P/c1-4-9-7-10-8(15(12,13)14)5-6-11(2)3/h8H,4-6H2,1-3H3,(H2,12,13,14) |
| InChIKey | OBZKKKNSXASBJH-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 85.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|