C9H21N2O5P — CID 71816118
[4-[acetyl(hydroxy)amino]-1-(trimethylazaniumyl)butan-2-yl]-hydroxyphosphinate (PubChem CID 71816118) has the molecular formula C9H21N2O5P and a molecular weight of 268.25 g/mol. Its IUPAC name is [4-[acetyl(hydroxy)amino]-1-(trimethylazaniumyl)butan-2-yl]-hydroxyphosphinate.
| Compound Name | [4-[acetyl(hydroxy)amino]-1-(trimethylazaniumyl)butan-2-yl]-hydroxyphosphinate |
|---|---|
| PubChem CID | 71816118 |
| Molecular Formula | C9H21N2O5P |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | [4-[acetyl(hydroxy)amino]-1-(trimethylazaniumyl)butan-2-yl]-hydroxyphosphinate |
| SMILES | CC(=O)N(O)CCC(C[N+](C)(C)C)P(=O)([O-])O |
| InChI | InChI=1S/C9H21N2O5P/c1-8(12)10(13)6-5-9(17(14,15)16)7-11(2,3)4/h9,13H,5-7H2,1-4H3,(H-,14,15,16) |
| InChIKey | FZNIGRXVIYCMJA-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|