C5H15NO4P+ — CID 19437707
(2-hydroxy-2-phosphonoethyl)-trimethylazanium (PubChem CID 19437707) has the molecular formula C5H15NO4P+ and a molecular weight of 184.15 g/mol. Its IUPAC name is (2-hydroxy-2-phosphonoethyl)-trimethylazanium.
| Compound Name | (2-hydroxy-2-phosphonoethyl)-trimethylazanium |
|---|---|
| PubChem CID | 19437707 |
| Molecular Formula | C5H15NO4P+ |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (2-hydroxy-2-phosphonoethyl)-trimethylazanium |
| SMILES | C[N+](C)(C)CC(O)P(=O)(O)O |
| InChI | InChI=1S/C5H14NO4P/c1-6(2,3)4-5(7)11(8,9)10/h5,7H,4H2,1-3H3,(H-,8,9,10)/p+1 |
| InChIKey | YJIOAKRBBHTUPD-UHFFFAOYSA-O |
| XLogP | -0.81 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|