hydrazine;(1-hydroxy-2-phosphonoethyl)phosphonic acid

C2H12N2O7P2 — CID 158563250

IUPAChydrazine;(1-hydroxy-2-phosphonoethyl)phosphonic acid
SMILESNN.O=P(O)(O)CC(O)P(=O)(O)O
InChIInChI=1S/C2H8O7P2.H4N2/c3-2(11(7,8)9)1-10(4,5)6;1-2/h2-3H,1H2,(H2,4,5,6)(H2,7,8,9);1-2H2
InChIKeyHRDOXKFXTLCPBQ-UHFFFAOYSA-N
MW238.07 g/mol
LogP-2.52
Rot. Bonds3

About hydrazine;(1-hydroxy-2-phosphonoethyl)phosphonic acid

hydrazine;(1-hydroxy-2-phosphonoethyl)phosphonic acid (PubChem CID 158563250) has the molecular formula C2H12N2O7P2 and a molecular weight of 238.07 g/mol. Its IUPAC name is hydrazine;(1-hydroxy-2-phosphonoethyl)phosphonic acid.

Molecular Properties

Compound Namehydrazine;(1-hydroxy-2-phosphonoethyl)phosphonic acid
PubChem CID158563250
Molecular FormulaC2H12N2O7P2
Molecular Weight238.07 g/mol
Exact Mass238.01
IUPAC Namehydrazine;(1-hydroxy-2-phosphonoethyl)phosphonic acid
SMILESNN.O=P(O)(O)CC(O)P(=O)(O)O
InChIInChI=1S/C2H8O7P2.H4N2/c3-2(11(7,8)9)1-10(4,5)6;1-2/h2-3H,1H2,(H2,4,5,6)(H2,7,8,9);1-2H2
InChIKeyHRDOXKFXTLCPBQ-UHFFFAOYSA-N
XLogP-2.52
TPSA187.33 Ų
H-Bond Donors7
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500238.07
LogP ≤ 5-2.52
H-Bond Donors ≤ 57
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze hydrazine;(1-hydroxy-2-phosphonoethyl)phosphonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

CID 88618709
CID 88618709
1-hydroxypropylphosphonic acid
CID 12625401
(1-hydroxy-3,3-diphosphonopropyl)phosphonic acid
CID 6452463
[(2R)-2-aminopropyl]phosphonic acid
CID 92524852
[(2R)-3-amino-2-fluoropropyl]phosphonic acid
CID 122184355
dihydroxymethylphosphonic acid
CID 13034651
[1-hydroxy-2-(methylamino)ethyl]phosphonic acid
CID 22237910
[(2R)-2-amino-3-methylbutyl]phosphonic acid
CID 102215252
1,2-dihydroxyethylphosphonic acid;dihydroxy(oxo)phosphanium
CID 87424977
(2-hydroxy-2-phosphonoethyl)-trimethylazanium
CID 19437707
[(2R)-1-phosphonopropan-2-yl]phosphonic acid
CID 7566477
1-phosphonopropan-2-ylphosphonic acid
CID 22023450

Frequently Asked Questions

What is the IUPAC name of hydrazine;(1-hydroxy-2-phosphonoethyl)phosphonic acid?
The IUPAC name of hydrazine;(1-hydroxy-2-phosphonoethyl)phosphonic acid (CID 158563250) is hydrazine;(1-hydroxy-2-phosphonoethyl)phosphonic acid.
What is the SMILES notation for hydrazine;(1-hydroxy-2-phosphonoethyl)phosphonic acid?
The canonical SMILES for hydrazine;(1-hydroxy-2-phosphonoethyl)phosphonic acid is NN.O=P(O)(O)CC(O)P(=O)(O)O.
What is the InChIKey of hydrazine;(1-hydroxy-2-phosphonoethyl)phosphonic acid?
The InChIKey is HRDOXKFXTLCPBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H8O7P2.H4N2/c3-2(11(7,8)9)1-10(4,5)6;1-2/h2-3H,1H2,(H2,4,5,6)(H2,7,8,9);1-2H2.
What are the key properties of hydrazine;(1-hydroxy-2-phosphonoethyl)phosphonic acid?
hydrazine;(1-hydroxy-2-phosphonoethyl)phosphonic acid has a molecular weight of 238.07 g/mol, XLogP of -2.52, 3 rotatable bonds, 7 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;(1-hydroxy-2-phosphonoethyl)phosphonic acid is sourced from PubChem (CID 158563250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).