C2H8NaO7P2 — CID 88618709
CID 88618709 (PubChem CID 88618709) has the molecular formula C2H8NaO7P2 and a molecular weight of 229.02 g/mol.
| Compound Name | CID 88618709 |
|---|---|
| PubChem CID | 88618709 |
| Molecular Formula | C2H8NaO7P2 |
| Molecular Weight | 229.02 g/mol |
| Exact Mass | 228.96 |
| IUPAC Name | — |
| SMILES | O=P(O)(O)CC(O)P(=O)(O)O.[Na] |
| InChI | InChI=1S/C2H8O7P2.Na/c3-2(11(7,8)9)1-10(4,5)6;/h2-3H,1H2,(H2,4,5,6)(H2,7,8,9); |
| InChIKey | MEUIXFZVDLEKCF-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.02 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|