C11H27INO2PS — CID 19351587
[2-di(propan-2-yl)phosphorylsulfanyl-2-hydroxyethyl]-trimethylazanium iodide (PubChem CID 19351587) has the molecular formula C11H27INO2PS and a molecular weight of 395.29 g/mol. Its IUPAC name is [2-di(propan-2-yl)phosphorylsulfanyl-2-hydroxyethyl]-trimethylazanium iodide.
| Compound Name | [2-di(propan-2-yl)phosphorylsulfanyl-2-hydroxyethyl]-trimethylazanium iodide |
|---|---|
| PubChem CID | 19351587 |
| Molecular Formula | C11H27INO2PS |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | [2-di(propan-2-yl)phosphorylsulfanyl-2-hydroxyethyl]-trimethylazanium iodide |
| SMILES | CC(C)P(=O)(SC(O)C[N+](C)(C)C)C(C)C.[I-] |
| InChI | InChI=1S/C11H27NO2PS.HI/c1-9(2)15(14,10(3)4)16-11(13)8-12(5,6)7;/h9-11,13H,8H2,1-7H3;1H/q+1;/p-1 |
| InChIKey | XFMWGHKWOYOGHQ-UHFFFAOYSA-M |
| XLogP | -0.16 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|