CH4K2O7P2 — CID 155666645
dipotassium;[hydroxy(phosphonato)methyl]phosphonic acid (PubChem CID 155666645) has the molecular formula CH4K2O7P2 and a molecular weight of 268.18 g/mol. Its IUPAC name is dipotassium;[hydroxy(phosphonato)methyl]phosphonic acid.
| Compound Name | dipotassium;[hydroxy(phosphonato)methyl]phosphonic acid |
|---|---|
| PubChem CID | 155666645 |
| Molecular Formula | CH4K2O7P2 |
| Molecular Weight | 268.18 g/mol |
| Exact Mass | 267.87 |
| IUPAC Name | dipotassium;[hydroxy(phosphonato)methyl]phosphonic acid |
| SMILES | O=P([O-])([O-])C(O)P(=O)(O)O.[K+].[K+] |
| InChI | InChI=1S/CH6O7P2.2K/c2-1(9(3,4)5)10(6,7)8;;/h1-2H,(H2,3,4,5)(H2,6,7,8);;/q;2*+1/p-2 |
| InChIKey | CRQLTTXTGGUTRW-UHFFFAOYSA-L |
| XLogP | -8.64 |
| TPSA | 140.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.18 |
| LogP ≤ 5 | -8.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|