About potassium;dihydrogen phosphate;2-hydroxypropanoic acid
potassium;dihydrogen phosphate;2-hydroxypropanoic acid (PubChem CID 174779739) has the molecular formula C3H8KO7P
and a molecular weight of 226.16 g/mol. Its IUPAC name is potassium;dihydrogen phosphate;2-hydroxypropanoic acid.
Molecular Properties
| Compound Name | potassium;dihydrogen phosphate;2-hydroxypropanoic acid |
| PubChem CID | 174779739 |
| Molecular Formula | C3H8KO7P |
| Molecular Weight | 226.16 g/mol |
| Exact Mass | 225.96 |
| IUPAC Name | potassium;dihydrogen phosphate;2-hydroxypropanoic acid |
| SMILES | CC(O)C(=O)O.O=P([O-])(O)O.[K+] |
| InChI | InChI=1S/C3H6O3.K.H3O4P/c1-2(4)3(5)6;;1-5(2,3)4/h2,4H,1H3,(H,5,6);;(H3,1,2,3,4)/q;+1;/p-1 |
| InChIKey | KASBTQUUEUMLDX-UHFFFAOYSA-M |
| XLogP | -5.10 |
| TPSA | 138.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.16 |
| LogP ≤ 5 | -5.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze potassium;dihydrogen phosphate;2-hydroxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;dihydrogen phosphate;2-hydroxypropanoic acid?
The IUPAC name of potassium;dihydrogen phosphate;2-hydroxypropanoic acid (CID 174779739) is potassium;dihydrogen phosphate;2-hydroxypropanoic acid.
What is the SMILES notation for potassium;dihydrogen phosphate;2-hydroxypropanoic acid?
The canonical SMILES for potassium;dihydrogen phosphate;2-hydroxypropanoic acid is CC(O)C(=O)O.O=P([O-])(O)O.[K+].
What is the InChIKey of potassium;dihydrogen phosphate;2-hydroxypropanoic acid?
The InChIKey is KASBTQUUEUMLDX-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6O3.K.H3O4P/c1-2(4)3(5)6;;1-5(2,3)4/h2,4H,1H3,(H,5,6);;(H3,1,2,3,4)/q;+1;/p-1.
What are the key properties of potassium;dihydrogen phosphate;2-hydroxypropanoic acid?
potassium;dihydrogen phosphate;2-hydroxypropanoic acid has a molecular weight of 226.16 g/mol, XLogP of -5.10, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;dihydrogen phosphate;2-hydroxypropanoic acid is sourced from PubChem (CID 174779739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).