C2H4Cl3NaO7P2 — CID 23704268
sodium [hydroxy(phosphono)methyl]-(trichloromethoxy)phosphinate (PubChem CID 23704268) has the molecular formula C2H4Cl3NaO7P2 and a molecular weight of 331.34 g/mol. Its IUPAC name is sodium [hydroxy(phosphono)methyl]-(trichloromethoxy)phosphinate.
| Compound Name | sodium [hydroxy(phosphono)methyl]-(trichloromethoxy)phosphinate |
|---|---|
| PubChem CID | 23704268 |
| Molecular Formula | C2H4Cl3NaO7P2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 329.84 |
| IUPAC Name | sodium [hydroxy(phosphono)methyl]-(trichloromethoxy)phosphinate |
| SMILES | O=P(O)(O)C(O)P(=O)([O-])OC(Cl)(Cl)Cl.[Na+] |
| InChI | InChI=1S/C2H5Cl3O7P2.Na/c3-2(4,5)12-14(10,11)1(6)13(7,8)9;/h1,6H,(H,10,11)(H2,7,8,9);/q;+1/p-1 |
| InChIKey | HKBJHKDOYMVWQR-UHFFFAOYSA-M |
| XLogP | -2.66 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|