C4H6Cl6O7P2 — CID 88724442
[2,2,2-trichloro-1-[hydroxy-(2,2,2-trichloro-1-hydroxyethyl)phosphoryl]oxyethyl]phosphonic acid (PubChem CID 88724442) has the molecular formula C4H6Cl6O7P2 and a molecular weight of 440.75 g/mol. Its IUPAC name is [2,2,2-trichloro-1-[hydroxy-(2,2,2-trichloro-1-hydroxyethyl)phosphoryl]oxyethyl]phosphonic acid.
| Compound Name | [2,2,2-trichloro-1-[hydroxy-(2,2,2-trichloro-1-hydroxyethyl)phosphoryl]oxyethyl]phosphonic acid |
|---|---|
| PubChem CID | 88724442 |
| Molecular Formula | C4H6Cl6O7P2 |
| Molecular Weight | 440.75 g/mol |
| Exact Mass | 437.77 |
| IUPAC Name | [2,2,2-trichloro-1-[hydroxy-(2,2,2-trichloro-1-hydroxyethyl)phosphoryl]oxyethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(OP(=O)(O)C(O)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C4H6Cl6O7P2/c5-3(6,7)1(11)19(15,16)17-2(4(8,9)10)18(12,13)14/h1-2,11H,(H,15,16)(H2,12,13,14) |
| InChIKey | CDXAYPQLJGOZIL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.75 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|