C3H5Cl3NO4P — CID 3313099
(2,2,2-trichloro-1-formamidoethyl)phosphonic acid (PubChem CID 3313099) has the molecular formula C3H5Cl3NO4P and a molecular weight of 256.41 g/mol. Its IUPAC name is (2,2,2-trichloro-1-formamidoethyl)phosphonic acid.
| Compound Name | (2,2,2-trichloro-1-formamidoethyl)phosphonic acid |
|---|---|
| PubChem CID | 3313099 |
| Molecular Formula | C3H5Cl3NO4P |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 254.90 |
| IUPAC Name | (2,2,2-trichloro-1-formamidoethyl)phosphonic acid |
| SMILES | O=CNC(C(Cl)(Cl)Cl)P(=O)(O)O |
| InChI | InChI=1S/C3H5Cl3NO4P/c4-3(5,6)2(7-1-8)12(9,10)11/h1-2H,(H,7,8)(H2,9,10,11) |
| InChIKey | BRFWZUNETUFQDQ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|