C31H29N5O4 — CID 174777313
8-hydroxy-N-[(4-morpholin-4-ylphenyl)methyl]quinoline-7-carboxamide;quinoline-7-carboxamide (PubChem CID 174777313) has the molecular formula C31H29N5O4 and a molecular weight of 535.60 g/mol. Its IUPAC name is 8-hydroxy-N-[(4-morpholin-4-ylphenyl)methyl]quinoline-7-carboxamide;quinoline-7-carboxamide.
| Compound Name | 8-hydroxy-N-[(4-morpholin-4-ylphenyl)methyl]quinoline-7-carboxamide;quinoline-7-carboxamide |
|---|---|
| PubChem CID | 174777313 |
| Molecular Formula | C31H29N5O4 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | 8-hydroxy-N-[(4-morpholin-4-ylphenyl)methyl]quinoline-7-carboxamide;quinoline-7-carboxamide |
| SMILES | NC(=O)c1ccc2cccnc2c1.O=C(NCc1ccc(N2CCOCC2)cc1)c1ccc2cccnc2c1O |
| InChI | InChI=1S/C21H21N3O3.C10H8N2O/c25-20-18(8-5-16-2-1-9-22-19(16)20)21(26)23-14-15-3-6-17(7-4-15)24-10-12-27-13-11-24;11-10(13)8-4-3-7-2-1-5-12-9(7)6-8/h1-9,25H,10-14H2,(H,23,26);1-6H,(H2,11,13) |
| InChIKey | WHMUBLIKZFNUKK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|