C24H21ClN2O3S — CID 174778613
[4-[[6-carbamoyl-4-(4-chlorophenyl)-1H-isoquinolin-2-yl]methyl]phenyl]methanesulfinic acid (PubChem CID 174778613) has the molecular formula C24H21ClN2O3S and a molecular weight of 452.96 g/mol. Its IUPAC name is [4-[[6-carbamoyl-4-(4-chlorophenyl)-1H-isoquinolin-2-yl]methyl]phenyl]methanesulfinic acid.
| Compound Name | [4-[[6-carbamoyl-4-(4-chlorophenyl)-1H-isoquinolin-2-yl]methyl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174778613 |
| Molecular Formula | C24H21ClN2O3S |
| Molecular Weight | 452.96 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | [4-[[6-carbamoyl-4-(4-chlorophenyl)-1H-isoquinolin-2-yl]methyl]phenyl]methanesulfinic acid |
| SMILES | NC(=O)c1ccc2c(c1)C(c1ccc(Cl)cc1)=CN(Cc1ccc(CS(=O)O)cc1)C2 |
| InChI | InChI=1S/C24H21ClN2O3S/c25-21-9-7-18(8-10-21)23-14-27(12-16-1-3-17(4-2-16)15-31(29)30)13-20-6-5-19(24(26)28)11-22(20)23/h1-11,14H,12-13,15H2,(H2,26,28)(H,29,30) |
| InChIKey | JRHJQPXQKPKZFF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.96 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|