C14H24N2O — CID 174780826
1-(3-amino-2,4-dimethylphenyl)ethanone;N-ethylethanamine (PubChem CID 174780826) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is 1-(3-amino-2,4-dimethylphenyl)ethanone;N-ethylethanamine.
| Compound Name | 1-(3-amino-2,4-dimethylphenyl)ethanone;N-ethylethanamine |
|---|---|
| PubChem CID | 174780826 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 1-(3-amino-2,4-dimethylphenyl)ethanone;N-ethylethanamine |
| SMILES | CC(=O)c1ccc(C)c(N)c1C.CCNCC |
| InChI | InChI=1S/C10H13NO.C4H11N/c1-6-4-5-9(8(3)12)7(2)10(6)11;1-3-5-4-2/h4-5H,11H2,1-3H3;5H,3-4H2,1-2H3 |
| InChIKey | RNTABOCVVRQXRL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|