C13H20N2O — CID 70049003
2-amino-N,N-diethyl-3,4-dimethylbenzamide (PubChem CID 70049003) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 2-amino-N,N-diethyl-3,4-dimethylbenzamide.
| Compound Name | 2-amino-N,N-diethyl-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 70049003 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 2-amino-N,N-diethyl-3,4-dimethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(C)c(C)c1N |
| InChI | InChI=1S/C13H20N2O/c1-5-15(6-2)13(16)11-8-7-9(3)10(4)12(11)14/h7-8H,5-6,14H2,1-4H3 |
| InChIKey | PVYWRJVVDDBYEZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|