C9H20O6S5 — CID 174785269
1,8-bis(sulfanyl)-4-(sulfanylmethyl)octane-3,6-disulfonic acid (PubChem CID 174785269) has the molecular formula C9H20O6S5 and a molecular weight of 384.59 g/mol. Its IUPAC name is 1,8-bis(sulfanyl)-4-(sulfanylmethyl)octane-3,6-disulfonic acid.
| Compound Name | 1,8-bis(sulfanyl)-4-(sulfanylmethyl)octane-3,6-disulfonic acid |
|---|---|
| PubChem CID | 174785269 |
| Molecular Formula | C9H20O6S5 |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 383.99 |
| IUPAC Name | 1,8-bis(sulfanyl)-4-(sulfanylmethyl)octane-3,6-disulfonic acid |
| SMILES | O=S(=O)(O)C(CCS)CC(CS)C(CCS)S(=O)(=O)O |
| InChI | InChI=1S/C9H20O6S5/c10-19(11,12)8(1-3-16)5-7(6-18)9(2-4-17)20(13,14)15/h7-9,16-18H,1-6H2,(H,10,11,12)(H,13,14,15) |
| InChIKey | NRJSVGWFGHLUNL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|