C13H28O9S5 — CID 174719031
5,7-bis(sulfanylmethyl)undecane-3,6,9-trisulfonic acid (PubChem CID 174719031) has the molecular formula C13H28O9S5 and a molecular weight of 488.69 g/mol. Its IUPAC name is 5,7-bis(sulfanylmethyl)undecane-3,6,9-trisulfonic acid.
| Compound Name | 5,7-bis(sulfanylmethyl)undecane-3,6,9-trisulfonic acid |
|---|---|
| PubChem CID | 174719031 |
| Molecular Formula | C13H28O9S5 |
| Molecular Weight | 488.69 g/mol |
| Exact Mass | 488.03 |
| IUPAC Name | 5,7-bis(sulfanylmethyl)undecane-3,6,9-trisulfonic acid |
| SMILES | CCC(CC(CS)C(C(CS)CC(CC)S(=O)(=O)O)S(=O)(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C13H28O9S5/c1-3-11(25(14,15)16)5-9(7-23)13(27(20,21)22)10(8-24)6-12(4-2)26(17,18)19/h9-13,23-24H,3-8H2,1-2H3,(H,14,15,16)(H,17,18,19)(H,20,21,22) |
| InChIKey | RYVZQUBUGLAYBB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 163.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.69 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|