C7H15NO4S — CID 90073176
6-amino-5-methyl-6-oxohexane-3-sulfonic acid (PubChem CID 90073176) has the molecular formula C7H15NO4S and a molecular weight of 209.27 g/mol. Its IUPAC name is 6-amino-5-methyl-6-oxohexane-3-sulfonic acid.
| Compound Name | 6-amino-5-methyl-6-oxohexane-3-sulfonic acid |
|---|---|
| PubChem CID | 90073176 |
| Molecular Formula | C7H15NO4S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 6-amino-5-methyl-6-oxohexane-3-sulfonic acid |
| SMILES | CCC(CC(C)C(N)=O)S(=O)(=O)O |
| InChI | InChI=1S/C7H15NO4S/c1-3-6(13(10,11)12)4-5(2)7(8)9/h5-6H,3-4H2,1-2H3,(H2,8,9)(H,10,11,12) |
| InChIKey | SQUWNHDACALSEE-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|