About dodecyl prop-2-enoate;prop-2-enoyl 2-methoxyprop-2-enoate
dodecyl prop-2-enoate;prop-2-enoyl 2-methoxyprop-2-enoate (PubChem CID 174785474) has the molecular formula C22H36O6
and a molecular weight of 396.52 g/mol. Its IUPAC name is dodecyl prop-2-enoate;prop-2-enoyl 2-methoxyprop-2-enoate.
Molecular Properties
| Compound Name | dodecyl prop-2-enoate;prop-2-enoyl 2-methoxyprop-2-enoate |
| PubChem CID | 174785474 |
| Molecular Formula | C22H36O6 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | dodecyl prop-2-enoate;prop-2-enoyl 2-methoxyprop-2-enoate |
| SMILES | C=CC(=O)OC(=O)C(=C)OC.C=CC(=O)OCCCCCCCCCCCC |
| InChI | InChI=1S/C15H28O2.C7H8O4/c1-3-5-6-7-8-9-10-11-12-13-14-17-15(16)4-2;1-4-6(8)11-7(9)5(2)10-3/h4H,2-3,5-14H2,1H3;4H,1-2H2,3H3 |
| InChIKey | PANJBTMEXYWTBO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dodecyl prop-2-enoate;prop-2-enoyl 2-methoxyprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecyl prop-2-enoate;prop-2-enoyl 2-methoxyprop-2-enoate?
The IUPAC name of dodecyl prop-2-enoate;prop-2-enoyl 2-methoxyprop-2-enoate (CID 174785474) is dodecyl prop-2-enoate;prop-2-enoyl 2-methoxyprop-2-enoate.
What is the SMILES notation for dodecyl prop-2-enoate;prop-2-enoyl 2-methoxyprop-2-enoate?
The canonical SMILES for dodecyl prop-2-enoate;prop-2-enoyl 2-methoxyprop-2-enoate is C=CC(=O)OC(=O)C(=C)OC.C=CC(=O)OCCCCCCCCCCCC.
What is the InChIKey of dodecyl prop-2-enoate;prop-2-enoyl 2-methoxyprop-2-enoate?
The InChIKey is PANJBTMEXYWTBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O2.C7H8O4/c1-3-5-6-7-8-9-10-11-12-13-14-17-15(16)4-2;1-4-6(8)11-7(9)5(2)10-3/h4H,2-3,5-14H2,1H3;4H,1-2H2,3H3.
What are the key properties of dodecyl prop-2-enoate;prop-2-enoyl 2-methoxyprop-2-enoate?
dodecyl prop-2-enoate;prop-2-enoyl 2-methoxyprop-2-enoate has a molecular weight of 396.52 g/mol, XLogP of 5.04, 15 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dodecyl prop-2-enoate;prop-2-enoyl 2-methoxyprop-2-enoate is sourced from PubChem (CID 174785474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).