C15H15AsN2O9 — CID 174786289
(2-acetamido-3-hydroxyphenyl)arsonic acid;2-nitrobenzoic acid (PubChem CID 174786289) has the molecular formula C15H15AsN2O9 and a molecular weight of 442.21 g/mol. Its IUPAC name is (2-acetamido-3-hydroxyphenyl)arsonic acid;2-nitrobenzoic acid.
| Compound Name | (2-acetamido-3-hydroxyphenyl)arsonic acid;2-nitrobenzoic acid |
|---|---|
| PubChem CID | 174786289 |
| Molecular Formula | C15H15AsN2O9 |
| Molecular Weight | 442.21 g/mol |
| Exact Mass | 442.00 |
| IUPAC Name | (2-acetamido-3-hydroxyphenyl)arsonic acid;2-nitrobenzoic acid |
| SMILES | CC(=O)Nc1c(O)cccc1[As](=O)(O)O.O=C(O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H10AsNO5.C7H5NO4/c1-5(11)10-8-6(9(13,14)15)3-2-4-7(8)12;9-7(10)5-3-1-2-4-6(5)8(11)12/h2-4,12H,1H3,(H,10,11)(H2,13,14,15);1-4H,(H,9,10) |
| InChIKey | FPXQOCKBPURVMZ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 187.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.21 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|