About diprop-2-enoyl 2-ethoxy-2-methylbutanedioate
diprop-2-enoyl 2-ethoxy-2-methylbutanedioate (PubChem CID 174786670) has the molecular formula C13H16O7
and a molecular weight of 284.26 g/mol. Its IUPAC name is diprop-2-enoyl 2-ethoxy-2-methylbutanedioate.
Molecular Properties
| Compound Name | diprop-2-enoyl 2-ethoxy-2-methylbutanedioate |
| PubChem CID | 174786670 |
| Molecular Formula | C13H16O7 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | diprop-2-enoyl 2-ethoxy-2-methylbutanedioate |
| SMILES | C=CC(=O)OC(=O)CC(C)(OCC)C(=O)OC(=O)C=C |
| InChI | InChI=1S/C13H16O7/c1-5-9(14)19-11(16)8-13(4,18-7-3)12(17)20-10(15)6-2/h5-6H,1-2,7-8H2,3-4H3 |
| InChIKey | IBFFTPKNYNAKCI-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze diprop-2-enoyl 2-ethoxy-2-methylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diprop-2-enoyl 2-ethoxy-2-methylbutanedioate?
The IUPAC name of diprop-2-enoyl 2-ethoxy-2-methylbutanedioate (CID 174786670) is diprop-2-enoyl 2-ethoxy-2-methylbutanedioate.
What is the SMILES notation for diprop-2-enoyl 2-ethoxy-2-methylbutanedioate?
The canonical SMILES for diprop-2-enoyl 2-ethoxy-2-methylbutanedioate is C=CC(=O)OC(=O)CC(C)(OCC)C(=O)OC(=O)C=C.
What is the InChIKey of diprop-2-enoyl 2-ethoxy-2-methylbutanedioate?
The InChIKey is IBFFTPKNYNAKCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O7/c1-5-9(14)19-11(16)8-13(4,18-7-3)12(17)20-10(15)6-2/h5-6H,1-2,7-8H2,3-4H3.
What are the key properties of diprop-2-enoyl 2-ethoxy-2-methylbutanedioate?
diprop-2-enoyl 2-ethoxy-2-methylbutanedioate has a molecular weight of 284.26 g/mol, XLogP of 0.68, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diprop-2-enoyl 2-ethoxy-2-methylbutanedioate is sourced from PubChem (CID 174786670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).