C21H31N5O — CID 174787783
4-[[5-methyl-7-(piperidin-4-ylmethylamino)-1H-indol-2-yl]methyl]piperazine-2-carbaldehyde (PubChem CID 174787783) has the molecular formula C21H31N5O and a molecular weight of 369.51 g/mol. Its IUPAC name is 4-[[5-methyl-7-(piperidin-4-ylmethylamino)-1H-indol-2-yl]methyl]piperazine-2-carbaldehyde.
| Compound Name | 4-[[5-methyl-7-(piperidin-4-ylmethylamino)-1H-indol-2-yl]methyl]piperazine-2-carbaldehyde |
|---|---|
| PubChem CID | 174787783 |
| Molecular Formula | C21H31N5O |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 4-[[5-methyl-7-(piperidin-4-ylmethylamino)-1H-indol-2-yl]methyl]piperazine-2-carbaldehyde |
| SMILES | Cc1cc(NCC2CCNCC2)c2[nH]c(CN3CCNC(C=O)C3)cc2c1 |
| InChI | InChI=1S/C21H31N5O/c1-15-8-17-10-18(12-26-7-6-23-19(13-26)14-27)25-21(17)20(9-15)24-11-16-2-4-22-5-3-16/h8-10,14,16,19,22-25H,2-7,11-13H2,1H3 |
| InChIKey | USTUSAOSTNJSLT-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|