C26H33O8P — CID 174787830
2,2-bis(hydroxymethyl)propane-1,3-diol;tris(2-methylphenyl) phosphate (PubChem CID 174787830) has the molecular formula C26H33O8P and a molecular weight of 504.52 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;tris(2-methylphenyl) phosphate.
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;tris(2-methylphenyl) phosphate |
|---|---|
| PubChem CID | 174787830 |
| Molecular Formula | C26H33O8P |
| Molecular Weight | 504.52 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;tris(2-methylphenyl) phosphate |
| SMILES | Cc1ccccc1OP(=O)(Oc1ccccc1C)Oc1ccccc1C.OCC(CO)(CO)CO |
| InChI | InChI=1S/C21H21O4P.C5H12O4/c1-16-10-4-7-13-19(16)23-26(22,24-20-14-8-5-11-17(20)2)25-21-15-9-6-12-18(21)3;6-1-5(2-7,3-8)4-9/h4-15H,1-3H3;6-9H,1-4H2 |
| InChIKey | USHJVFBAGLYSIJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|