C12H23NO13Zn — CID 174788251
(3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;2,3,4,5-tetrahydroxyhexanedioic acid;zinc (PubChem CID 174788251) has the molecular formula C12H23NO13Zn and a molecular weight of 454.70 g/mol. Its IUPAC name is (3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;2,3,4,5-tetrahydroxyhexanedioic acid;zinc.
| Compound Name | (3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;2,3,4,5-tetrahydroxyhexanedioic acid;zinc |
|---|---|
| PubChem CID | 174788251 |
| Molecular Formula | C12H23NO13Zn |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | (3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;2,3,4,5-tetrahydroxyhexanedioic acid;zinc |
| SMILES | N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O.O=C(O)C(O)C(O)C(O)C(O)C(=O)O.[Zn] |
| InChI | InChI=1S/C6H13NO5.C6H10O8.Zn/c7-3-5(10)4(9)2(1-8)12-6(3)11;7-1(3(9)5(11)12)2(8)4(10)6(13)14;/h2-6,8-11H,1,7H2;1-4,7-10H,(H,11,12)(H,13,14);/t2-,3-,4-,5-,6?;;/m1../s1 |
| InChIKey | KXFVPICXWJIWJS-QOJDFBNTSA-N |
| XLogP | -6.66 |
| TPSA | 271.69 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | -6.66 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|