C19H17F2NO — CID 174788399
1,7-difluoro-6-methoxy-3-(4-propan-2-ylphenyl)isoquinoline (PubChem CID 174788399) has the molecular formula C19H17F2NO and a molecular weight of 313.35 g/mol. Its IUPAC name is 1,7-difluoro-6-methoxy-3-(4-propan-2-ylphenyl)isoquinoline.
| Compound Name | 1,7-difluoro-6-methoxy-3-(4-propan-2-ylphenyl)isoquinoline |
|---|---|
| PubChem CID | 174788399 |
| Molecular Formula | C19H17F2NO |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 1,7-difluoro-6-methoxy-3-(4-propan-2-ylphenyl)isoquinoline |
| SMILES | COc1cc2cc(-c3ccc(C(C)C)cc3)nc(F)c2cc1F |
| InChI | InChI=1S/C19H17F2NO/c1-11(2)12-4-6-13(7-5-12)17-8-14-9-18(23-3)16(20)10-15(14)19(21)22-17/h4-11H,1-3H3 |
| InChIKey | LILKOTLODCGEDH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|