C11H14Cl4N6O3 — CID 174790205
1-chloropentane;1,3,5-triazinane-2,4,6-trione;2,4,6-trichloro-1,3,5-triazine (PubChem CID 174790205) has the molecular formula C11H14Cl4N6O3 and a molecular weight of 420.08 g/mol. Its IUPAC name is 1-chloropentane;1,3,5-triazinane-2,4,6-trione;2,4,6-trichloro-1,3,5-triazine.
| Compound Name | 1-chloropentane;1,3,5-triazinane-2,4,6-trione;2,4,6-trichloro-1,3,5-triazine |
|---|---|
| PubChem CID | 174790205 |
| Molecular Formula | C11H14Cl4N6O3 |
| Molecular Weight | 420.08 g/mol |
| Exact Mass | 417.99 |
| IUPAC Name | 1-chloropentane;1,3,5-triazinane-2,4,6-trione;2,4,6-trichloro-1,3,5-triazine |
| SMILES | CCCCCCl.Clc1nc(Cl)nc(Cl)n1.O=c1[nH]c(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C5H11Cl.C3Cl3N3.C3H3N3O3/c1-2-3-4-5-6;4-1-7-2(5)9-3(6)8-1;7-1-4-2(8)6-3(9)5-1/h2-5H2,1H3;;(H3,4,5,6,7,8,9) |
| InChIKey | USMWSHBYFXXAHK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 137.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.08 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|