C20H25N3O5S — CID 17479380
3,4,5-trimethoxy-N'-[2-(2-thiophen-2-ylpyrrolidin-1-yl)acetyl]benzohydrazide (PubChem CID 17479380) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N'-[2-(2-thiophen-2-ylpyrrolidin-1-yl)acetyl]benzohydrazide.
| Compound Name | 3,4,5-trimethoxy-N'-[2-(2-thiophen-2-ylpyrrolidin-1-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 17479380 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 3,4,5-trimethoxy-N'-[2-(2-thiophen-2-ylpyrrolidin-1-yl)acetyl]benzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)CN2CCCC2c2cccs2)cc(OC)c1OC |
| InChI | InChI=1S/C20H25N3O5S/c1-26-15-10-13(11-16(27-2)19(15)28-3)20(25)22-21-18(24)12-23-8-4-6-14(23)17-7-5-9-29-17/h5,7,9-11,14H,4,6,8,12H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | GMEBJRQLOWNRPG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|