C19H23NO4S — CID 90522152
(4-thiophen-2-ylpiperidin-1-yl)-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 90522152) has the molecular formula C19H23NO4S and a molecular weight of 361.46 g/mol. Its IUPAC name is (4-thiophen-2-ylpiperidin-1-yl)-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | (4-thiophen-2-ylpiperidin-1-yl)-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 90522152 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | (4-thiophen-2-ylpiperidin-1-yl)-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)N2CCC(c3cccs3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C19H23NO4S/c1-22-15-11-14(12-16(23-2)18(15)24-3)19(21)20-8-6-13(7-9-20)17-5-4-10-25-17/h4-5,10-13H,6-9H2,1-3H3 |
| InChIKey | VYUURNBKVIVPCI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |