C12H21N3O8 — CID 174796115
2-[amino-[(8S)-8-amino-8-carboxy-3-oxooct-1-en-4-yl]amino]propanedioic acid;hydrate (PubChem CID 174796115) has the molecular formula C12H21N3O8 and a molecular weight of 335.31 g/mol. Its IUPAC name is 2-[amino-[(8S)-8-amino-8-carboxy-3-oxooct-1-en-4-yl]amino]propanedioic acid;hydrate.
| Compound Name | 2-[amino-[(8S)-8-amino-8-carboxy-3-oxooct-1-en-4-yl]amino]propanedioic acid;hydrate |
|---|---|
| PubChem CID | 174796115 |
| Molecular Formula | C12H21N3O8 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 2-[amino-[(8S)-8-amino-8-carboxy-3-oxooct-1-en-4-yl]amino]propanedioic acid;hydrate |
| SMILES | C=CC(=O)C(CCC[C@H](N)C(=O)O)N(N)C(C(=O)O)C(=O)O.O |
| InChI | InChI=1S/C12H19N3O7.H2O/c1-2-8(16)7(5-3-4-6(13)10(17)18)15(14)9(11(19)20)12(21)22;/h2,6-7,9H,1,3-5,13-14H2,(H,17,18)(H,19,20)(H,21,22);1H2/t6-,7?;/m0./s1 |
| InChIKey | AUPRHXSMZAZPTE-OXIGJRIQSA-N |
| XLogP | -2.42 |
| TPSA | 215.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|