C21H30N2O2 — CID 174798526
(1R)-1-[4-[(2-amino-4-methoxyphenyl)methyl]piperidin-1-yl]-6-ethylcyclohexa-2,4-dien-1-ol (PubChem CID 174798526) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is (1R)-1-[4-[(2-amino-4-methoxyphenyl)methyl]piperidin-1-yl]-6-ethylcyclohexa-2,4-dien-1-ol.
| Compound Name | (1R)-1-[4-[(2-amino-4-methoxyphenyl)methyl]piperidin-1-yl]-6-ethylcyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 174798526 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | (1R)-1-[4-[(2-amino-4-methoxyphenyl)methyl]piperidin-1-yl]-6-ethylcyclohexa-2,4-dien-1-ol |
| SMILES | CCC1C=CC=C[C@]1(O)N1CCC(Cc2ccc(OC)cc2N)CC1 |
| InChI | InChI=1S/C21H30N2O2/c1-3-18-6-4-5-11-21(18,24)23-12-9-16(10-13-23)14-17-7-8-19(25-2)15-20(17)22/h4-8,11,15-16,18,24H,3,9-10,12-14,22H2,1-2H3/t18?,21-/m1/s1 |
| InChIKey | WDOAADFDYAQWED-BDPMCISCSA-N |
| XLogP | 3.37 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|