C16H24N2O — CID 59353025
5-methoxy-2-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]methyl]aniline (PubChem CID 59353025) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 5-methoxy-2-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]methyl]aniline.
| Compound Name | 5-methoxy-2-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]methyl]aniline |
|---|---|
| PubChem CID | 59353025 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 5-methoxy-2-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]methyl]aniline |
| SMILES | COc1ccc(CC2C[C@H]3CC[C@@H](C2)N3C)c(N)c1 |
| InChI | InChI=1S/C16H24N2O/c1-18-13-4-5-14(18)9-11(8-13)7-12-3-6-15(19-2)10-16(12)17/h3,6,10-11,13-14H,4-5,7-9,17H2,1-2H3/t11?,13-,14+ |
| InChIKey | CJMBAKHGAWXPKX-QXMXGUDHSA-N |
| XLogP | 2.69 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|