C19H27ClN2O2 — CID 174799119
tert-butyl formate;3-[4-(4-chlorophenyl)piperidin-4-yl]propanenitrile (PubChem CID 174799119) has the molecular formula C19H27ClN2O2 and a molecular weight of 350.89 g/mol. Its IUPAC name is tert-butyl formate;3-[4-(4-chlorophenyl)piperidin-4-yl]propanenitrile.
| Compound Name | tert-butyl formate;3-[4-(4-chlorophenyl)piperidin-4-yl]propanenitrile |
|---|---|
| PubChem CID | 174799119 |
| Molecular Formula | C19H27ClN2O2 |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | tert-butyl formate;3-[4-(4-chlorophenyl)piperidin-4-yl]propanenitrile |
| SMILES | CC(C)(C)OC=O.N#CCCC1(c2ccc(Cl)cc2)CCNCC1 |
| InChI | InChI=1S/C14H17ClN2.C5H10O2/c15-13-4-2-12(3-5-13)14(6-1-9-16)7-10-17-11-8-14;1-5(2,3)7-4-6/h2-5,17H,1,6-8,10-11H2;4H,1-3H3 |
| InChIKey | PZNFRMXCLJFSNM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|