C19H19Cl2N3O3 — CID 174799453
3-(3,5-dichlorophenyl)imidazolidine-2,4-dione;N-propan-2-ylbenzamide (PubChem CID 174799453) has the molecular formula C19H19Cl2N3O3 and a molecular weight of 408.29 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)imidazolidine-2,4-dione;N-propan-2-ylbenzamide.
| Compound Name | 3-(3,5-dichlorophenyl)imidazolidine-2,4-dione;N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 174799453 |
| Molecular Formula | C19H19Cl2N3O3 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 3-(3,5-dichlorophenyl)imidazolidine-2,4-dione;N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1ccccc1.O=C1CNC(=O)N1c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C10H13NO.C9H6Cl2N2O2/c1-8(2)11-10(12)9-6-4-3-5-7-9;10-5-1-6(11)3-7(2-5)13-8(14)4-12-9(13)15/h3-8H,1-2H3,(H,11,12);1-3H,4H2,(H,12,15) |
| InChIKey | CGXLGQQRFHAIBI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|