C6H12N2O5S — CID 174800474
1-prop-2-enylimidazolidin-2-one;sulfuric acid (PubChem CID 174800474) has the molecular formula C6H12N2O5S and a molecular weight of 224.24 g/mol. Its IUPAC name is 1-prop-2-enylimidazolidin-2-one;sulfuric acid.
| Compound Name | 1-prop-2-enylimidazolidin-2-one;sulfuric acid |
|---|---|
| PubChem CID | 174800474 |
| Molecular Formula | C6H12N2O5S |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 1-prop-2-enylimidazolidin-2-one;sulfuric acid |
| SMILES | C=CCN1CCNC1=O.O=S(=O)(O)O |
| InChI | InChI=1S/C6H10N2O.H2O4S/c1-2-4-8-5-3-7-6(8)9;1-5(2,3)4/h2H,1,3-5H2,(H,7,9);(H2,1,2,3,4) |
| InChIKey | ISXCCYXRVVLGDD-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|