C13H23NO7S — CID 174803197
8-(1-prop-2-enoyloxyethylamino)-7-sulfooctanoic acid (PubChem CID 174803197) has the molecular formula C13H23NO7S and a molecular weight of 337.39 g/mol. Its IUPAC name is 8-(1-prop-2-enoyloxyethylamino)-7-sulfooctanoic acid.
| Compound Name | 8-(1-prop-2-enoyloxyethylamino)-7-sulfooctanoic acid |
|---|---|
| PubChem CID | 174803197 |
| Molecular Formula | C13H23NO7S |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 8-(1-prop-2-enoyloxyethylamino)-7-sulfooctanoic acid |
| SMILES | C=CC(=O)OC(C)NCC(CCCCCC(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C13H23NO7S/c1-3-13(17)21-10(2)14-9-11(22(18,19)20)7-5-4-6-8-12(15)16/h3,10-11,14H,1,4-9H2,2H3,(H,15,16)(H,18,19,20) |
| InChIKey | GKODTEMEAXQLKP-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|