C12H26O4S — CID 174804840
but-1-ene;1-pentoxypropane-1-sulfonic acid (PubChem CID 174804840) has the molecular formula C12H26O4S and a molecular weight of 266.40 g/mol. Its IUPAC name is but-1-ene;1-pentoxypropane-1-sulfonic acid.
| Compound Name | but-1-ene;1-pentoxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 174804840 |
| Molecular Formula | C12H26O4S |
| Molecular Weight | 266.40 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | but-1-ene;1-pentoxypropane-1-sulfonic acid |
| SMILES | C=CCC.CCCCCOC(CC)S(=O)(=O)O |
| InChI | InChI=1S/C8H18O4S.C4H8/c1-3-5-6-7-12-8(4-2)13(9,10)11;1-3-4-2/h8H,3-7H2,1-2H3,(H,9,10,11);3H,1,4H2,2H3 |
| InChIKey | UHYVQHVDIZSGQQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|