C21H26N2O4 — CID 17480503
N-[(4-benzylmorpholin-2-yl)methyl]-3,5-dimethoxybenzamide (PubChem CID 17480503) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-[(4-benzylmorpholin-2-yl)methyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[(4-benzylmorpholin-2-yl)methyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 17480503 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | N-[(4-benzylmorpholin-2-yl)methyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCC2CN(Cc3ccccc3)CCO2)c1 |
| InChI | InChI=1S/C21H26N2O4/c1-25-18-10-17(11-19(12-18)26-2)21(24)22-13-20-15-23(8-9-27-20)14-16-6-4-3-5-7-16/h3-7,10-12,20H,8-9,13-15H2,1-2H3,(H,22,24) |
| InChIKey | BAIYQYBEOPPHGN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |