C23H26N2O4 — CID 8504022
N-[[(2S)-4-benzylmorpholin-2-yl]methyl]-5-methoxy-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 8504022) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is N-[[(2S)-4-benzylmorpholin-2-yl]methyl]-5-methoxy-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-[[(2S)-4-benzylmorpholin-2-yl]methyl]-5-methoxy-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 8504022 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | N-[[(2S)-4-benzylmorpholin-2-yl]methyl]-5-methoxy-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc2oc(C(=O)NC[C@H]3CN(Cc4ccccc4)CCO3)c(C)c2c1 |
| InChI | InChI=1S/C23H26N2O4/c1-16-20-12-18(27-2)8-9-21(20)29-22(16)23(26)24-13-19-15-25(10-11-28-19)14-17-6-4-3-5-7-17/h3-9,12,19H,10-11,13-15H2,1-2H3,(H,24,26)/t19-/m0/s1 |
| InChIKey | CYAIREJQUCWGSA-IBGZPJMESA-N |
| XLogP | 3.38 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |