About butyl(trichloro)stannane;2-hydroxyethyl(trimethyl)azanium
butyl(trichloro)stannane;2-hydroxyethyl(trimethyl)azanium (PubChem CID 174805422) has the molecular formula C9H23Cl3NOSn+
and a molecular weight of 386.36 g/mol. Its IUPAC name is butyl(trichloro)stannane;2-hydroxyethyl(trimethyl)azanium.
Molecular Properties
| Compound Name | butyl(trichloro)stannane;2-hydroxyethyl(trimethyl)azanium |
| PubChem CID | 174805422 |
| Molecular Formula | C9H23Cl3NOSn+ |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | butyl(trichloro)stannane;2-hydroxyethyl(trimethyl)azanium |
| SMILES | CCCC[Sn](Cl)(Cl)Cl.C[N+](C)(C)CCO |
| InChI | InChI=1S/C5H14NO.C4H9.3ClH.Sn/c1-6(2,3)4-5-7;1-3-4-2;;;;/h7H,4-5H2,1-3H3;1,3-4H2,2H3;3*1H;/q+1;;;;;+3/p-3 |
| InChIKey | PGCGPZDLRVMJEP-UHFFFAOYSA-K |
| XLogP | 3.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze butyl(trichloro)stannane;2-hydroxyethyl(trimethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl(trichloro)stannane;2-hydroxyethyl(trimethyl)azanium?
The IUPAC name of butyl(trichloro)stannane;2-hydroxyethyl(trimethyl)azanium (CID 174805422) is butyl(trichloro)stannane;2-hydroxyethyl(trimethyl)azanium.
What is the SMILES notation for butyl(trichloro)stannane;2-hydroxyethyl(trimethyl)azanium?
The canonical SMILES for butyl(trichloro)stannane;2-hydroxyethyl(trimethyl)azanium is CCCC[Sn](Cl)(Cl)Cl.C[N+](C)(C)CCO.
What is the InChIKey of butyl(trichloro)stannane;2-hydroxyethyl(trimethyl)azanium?
The InChIKey is PGCGPZDLRVMJEP-UHFFFAOYSA-K. The full InChI is InChI=1S/C5H14NO.C4H9.3ClH.Sn/c1-6(2,3)4-5-7;1-3-4-2;;;;/h7H,4-5H2,1-3H3;1,3-4H2,2H3;3*1H;/q+1;;;;;+3/p-3.
What are the key properties of butyl(trichloro)stannane;2-hydroxyethyl(trimethyl)azanium?
butyl(trichloro)stannane;2-hydroxyethyl(trimethyl)azanium has a molecular weight of 386.36 g/mol, XLogP of 3.13, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butyl(trichloro)stannane;2-hydroxyethyl(trimethyl)azanium is sourced from PubChem (CID 174805422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).