C30H60O8 — CID 174806808
1,1-bis(tert-butylperoxy)cyclohexane;1,4-bis(tert-butylperoxy)-1,4-dimethylcyclohexane (PubChem CID 174806808) has the molecular formula C30H60O8 and a molecular weight of 548.80 g/mol. Its IUPAC name is 1,1-bis(tert-butylperoxy)cyclohexane;1,4-bis(tert-butylperoxy)-1,4-dimethylcyclohexane.
| Compound Name | 1,1-bis(tert-butylperoxy)cyclohexane;1,4-bis(tert-butylperoxy)-1,4-dimethylcyclohexane |
|---|---|
| PubChem CID | 174806808 |
| Molecular Formula | C30H60O8 |
| Molecular Weight | 548.80 g/mol |
| Exact Mass | 548.43 |
| IUPAC Name | 1,1-bis(tert-butylperoxy)cyclohexane;1,4-bis(tert-butylperoxy)-1,4-dimethylcyclohexane |
| SMILES | CC(C)(C)OOC1(C)CCC(C)(OOC(C)(C)C)CC1.CC(C)(C)OOC1(OOC(C)(C)C)CCCCC1 |
| InChI | InChI=1S/C16H32O4.C14H28O4/c1-13(2,3)17-19-15(7)9-11-16(8,12-10-15)20-18-14(4,5)6;1-12(2,3)15-17-14(10-8-7-9-11-14)18-16-13(4,5)6/h9-12H2,1-8H3;7-11H2,1-6H3 |
| InChIKey | UIQJSOPLXJBGNJ-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.80 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|