C16H32O4 — CID 19906449
1,4-bis(tert-butylperoxy)-1,4-dimethylcyclohexane (PubChem CID 19906449) has the molecular formula C16H32O4 and a molecular weight of 288.43 g/mol. Its IUPAC name is 1,4-bis(tert-butylperoxy)-1,4-dimethylcyclohexane.
| Compound Name | 1,4-bis(tert-butylperoxy)-1,4-dimethylcyclohexane |
|---|---|
| PubChem CID | 19906449 |
| Molecular Formula | C16H32O4 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 1,4-bis(tert-butylperoxy)-1,4-dimethylcyclohexane |
| SMILES | CC(C)(C)OOC1(C)CCC(C)(OOC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H32O4/c1-13(2,3)17-19-15(7)9-11-16(8,12-10-15)20-18-14(4,5)6/h9-12H2,1-8H3 |
| InChIKey | KVPKGAFEIYMIFE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|