C12H27NO3S — CID 174807059
3-amino-2-methyloctane-2-sulfonic acid;prop-1-ene (PubChem CID 174807059) has the molecular formula C12H27NO3S and a molecular weight of 265.42 g/mol. Its IUPAC name is 3-amino-2-methyloctane-2-sulfonic acid;prop-1-ene.
| Compound Name | 3-amino-2-methyloctane-2-sulfonic acid;prop-1-ene |
|---|---|
| PubChem CID | 174807059 |
| Molecular Formula | C12H27NO3S |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 3-amino-2-methyloctane-2-sulfonic acid;prop-1-ene |
| SMILES | C=CC.CCCCCC(N)C(C)(C)S(=O)(=O)O |
| InChI | InChI=1S/C9H21NO3S.C3H6/c1-4-5-6-7-8(10)9(2,3)14(11,12)13;1-3-2/h8H,4-7,10H2,1-3H3,(H,11,12,13);3H,1H2,2H3 |
| InChIKey | WEEKJDNLWLYABV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|