About azane;2-(dimethylamino)heptane-1-sulfonic acid;prop-1-ene
azane;2-(dimethylamino)heptane-1-sulfonic acid;prop-1-ene (PubChem CID 174911626) has the molecular formula C12H30N2O3S
and a molecular weight of 282.45 g/mol. Its IUPAC name is azane;2-(dimethylamino)heptane-1-sulfonic acid;prop-1-ene.
Molecular Properties
| Compound Name | azane;2-(dimethylamino)heptane-1-sulfonic acid;prop-1-ene |
| PubChem CID | 174911626 |
| Molecular Formula | C12H30N2O3S |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | azane;2-(dimethylamino)heptane-1-sulfonic acid;prop-1-ene |
| SMILES | C=CC.CCCCCC(CS(=O)(=O)O)N(C)C.N |
| InChI | InChI=1S/C9H21NO3S.C3H6.H3N/c1-4-5-6-7-9(10(2)3)8-14(11,12)13;1-3-2;/h9H,4-8H2,1-3H3,(H,11,12,13);3H,1H2,2H3;1H3 |
| InChIKey | MOPPJQAIUAHCGL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze azane;2-(dimethylamino)heptane-1-sulfonic acid;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-(dimethylamino)heptane-1-sulfonic acid;prop-1-ene?
The IUPAC name of azane;2-(dimethylamino)heptane-1-sulfonic acid;prop-1-ene (CID 174911626) is azane;2-(dimethylamino)heptane-1-sulfonic acid;prop-1-ene.
What is the SMILES notation for azane;2-(dimethylamino)heptane-1-sulfonic acid;prop-1-ene?
The canonical SMILES for azane;2-(dimethylamino)heptane-1-sulfonic acid;prop-1-ene is C=CC.CCCCCC(CS(=O)(=O)O)N(C)C.N.
What is the InChIKey of azane;2-(dimethylamino)heptane-1-sulfonic acid;prop-1-ene?
The InChIKey is MOPPJQAIUAHCGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21NO3S.C3H6.H3N/c1-4-5-6-7-9(10(2)3)8-14(11,12)13;1-3-2;/h9H,4-8H2,1-3H3,(H,11,12,13);3H,1H2,2H3;1H3.
What are the key properties of azane;2-(dimethylamino)heptane-1-sulfonic acid;prop-1-ene?
azane;2-(dimethylamino)heptane-1-sulfonic acid;prop-1-ene has a molecular weight of 282.45 g/mol, XLogP of 2.74, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-(dimethylamino)heptane-1-sulfonic acid;prop-1-ene is sourced from PubChem (CID 174911626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).