C11H23NO3S — CID 174712619
2-[methyl(pentyl)amino]pent-4-ene-1-sulfonic acid (PubChem CID 174712619) has the molecular formula C11H23NO3S and a molecular weight of 249.38 g/mol. Its IUPAC name is 2-[methyl(pentyl)amino]pent-4-ene-1-sulfonic acid.
| Compound Name | 2-[methyl(pentyl)amino]pent-4-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 174712619 |
| Molecular Formula | C11H23NO3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 2-[methyl(pentyl)amino]pent-4-ene-1-sulfonic acid |
| SMILES | C=CCC(CS(=O)(=O)O)N(C)CCCCC |
| InChI | InChI=1S/C11H23NO3S/c1-4-6-7-9-12(3)11(8-5-2)10-16(13,14)15/h5,11H,2,4,6-10H2,1,3H3,(H,13,14,15) |
| InChIKey | HGSNSRIGZYLPDT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|