C23H42N2 — CID 88799843
formonitrile;N-hepta-1,6-dien-4-yl-N-prop-2-enyldodecan-1-amine (PubChem CID 88799843) has the molecular formula C23H42N2 and a molecular weight of 346.60 g/mol. Its IUPAC name is formonitrile;N-hepta-1,6-dien-4-yl-N-prop-2-enyldodecan-1-amine.
| Compound Name | formonitrile;N-hepta-1,6-dien-4-yl-N-prop-2-enyldodecan-1-amine |
|---|---|
| PubChem CID | 88799843 |
| Molecular Formula | C23H42N2 |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 346.33 |
| IUPAC Name | formonitrile;N-hepta-1,6-dien-4-yl-N-prop-2-enyldodecan-1-amine |
| SMILES | C#N.C=CCC(CC=C)N(CC=C)CCCCCCCCCCCC |
| InChI | InChI=1S/C22H41N.CHN/c1-5-9-10-11-12-13-14-15-16-17-21-23(20-8-4)22(18-6-2)19-7-3;1-2/h6-8,22H,2-5,9-21H2,1H3;1H |
| InChIKey | JUBIEAZZLYXPNS-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|