C14H12Cl2N2O2 — CID 174807844
[6-(2,4-dichloroanilino)-5-methyl-2-pyridinyl]methyl formate (PubChem CID 174807844) has the molecular formula C14H12Cl2N2O2 and a molecular weight of 311.17 g/mol. Its IUPAC name is [6-(2,4-dichloroanilino)-5-methyl-2-pyridinyl]methyl formate.
| Compound Name | [6-(2,4-dichloroanilino)-5-methyl-2-pyridinyl]methyl formate |
|---|---|
| PubChem CID | 174807844 |
| Molecular Formula | C14H12Cl2N2O2 |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | [6-(2,4-dichloroanilino)-5-methyl-2-pyridinyl]methyl formate |
| SMILES | Cc1ccc(COC=O)nc1Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H12Cl2N2O2/c1-9-2-4-11(7-20-8-19)17-14(9)18-13-5-3-10(15)6-12(13)16/h2-6,8H,7H2,1H3,(H,17,18) |
| InChIKey | FAMIFIDMSMMHOO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|