C12H13Cl2N3O2 — CID 23465964
ethyl 2-(2,4-dichloroanilino)-4,5-dihydroimidazole-1-carboxylate (PubChem CID 23465964) has the molecular formula C12H13Cl2N3O2 and a molecular weight of 302.16 g/mol. Its IUPAC name is ethyl 2-(2,4-dichloroanilino)-4,5-dihydroimidazole-1-carboxylate.
| Compound Name | ethyl 2-(2,4-dichloroanilino)-4,5-dihydroimidazole-1-carboxylate |
|---|---|
| PubChem CID | 23465964 |
| Molecular Formula | C12H13Cl2N3O2 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | ethyl 2-(2,4-dichloroanilino)-4,5-dihydroimidazole-1-carboxylate |
| SMILES | CCOC(=O)N1CCN=C1Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H13Cl2N3O2/c1-2-19-12(18)17-6-5-15-11(17)16-10-4-3-8(13)7-9(10)14/h3-4,7H,2,5-6H2,1H3,(H,15,16) |
| InChIKey | OGVXRIXTFXZGEJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |