About (4-chlorophenyl)-[2-(2,3-dichloroanilino)-4,5-dihydroimidazol-1-yl]methanone
(4-chlorophenyl)-[2-(2,3-dichloroanilino)-4,5-dihydroimidazol-1-yl]methanone (PubChem CID 13189163) has the molecular formula C16H12Cl3N3O
and a molecular weight of 368.65 g/mol. Its IUPAC name is (4-chlorophenyl)-[2-(2,3-dichloroanilino)-4,5-dihydroimidazol-1-yl]methanone.
Molecular Properties
| Compound Name | (4-chlorophenyl)-[2-(2,3-dichloroanilino)-4,5-dihydroimidazol-1-yl]methanone |
| PubChem CID | 13189163 |
| Molecular Formula | C16H12Cl3N3O |
| Molecular Weight | 368.65 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | (4-chlorophenyl)-[2-(2,3-dichloroanilino)-4,5-dihydroimidazol-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCN=C1Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H12Cl3N3O/c17-11-6-4-10(5-7-11)15(23)22-9-8-20-16(22)21-13-3-1-2-12(18)14(13)19/h1-7H,8-9H2,(H,20,21) |
| InChIKey | GCINRLFINZQWPS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.65 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-chlorophenyl)-[2-(2,3-dichloroanilino)-4,5-dihydroimidazol-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)-[2-(2,3-dichloroanilino)-4,5-dihydroimidazol-1-yl]methanone?
The IUPAC name of (4-chlorophenyl)-[2-(2,3-dichloroanilino)-4,5-dihydroimidazol-1-yl]methanone (CID 13189163) is (4-chlorophenyl)-[2-(2,3-dichloroanilino)-4,5-dihydroimidazol-1-yl]methanone.
What is the SMILES notation for (4-chlorophenyl)-[2-(2,3-dichloroanilino)-4,5-dihydroimidazol-1-yl]methanone?
The canonical SMILES for (4-chlorophenyl)-[2-(2,3-dichloroanilino)-4,5-dihydroimidazol-1-yl]methanone is O=C(c1ccc(Cl)cc1)N1CCN=C1Nc1cccc(Cl)c1Cl.
What is the InChIKey of (4-chlorophenyl)-[2-(2,3-dichloroanilino)-4,5-dihydroimidazol-1-yl]methanone?
The InChIKey is GCINRLFINZQWPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12Cl3N3O/c17-11-6-4-10(5-7-11)15(23)22-9-8-20-16(22)21-13-3-1-2-12(18)14(13)19/h1-7H,8-9H2,(H,20,21).
What are the key properties of (4-chlorophenyl)-[2-(2,3-dichloroanilino)-4,5-dihydroimidazol-1-yl]methanone?
(4-chlorophenyl)-[2-(2,3-dichloroanilino)-4,5-dihydroimidazol-1-yl]methanone has a molecular weight of 368.65 g/mol, XLogP of 4.57, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)-[2-(2,3-dichloroanilino)-4,5-dihydroimidazol-1-yl]methanone is sourced from PubChem (CID 13189163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).