C16H13Cl2N3O — CID 23465952
[2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]-phenylmethanone (PubChem CID 23465952) has the molecular formula C16H13Cl2N3O and a molecular weight of 334.21 g/mol. Its IUPAC name is [2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]-phenylmethanone.
| Compound Name | [2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 23465952 |
| Molecular Formula | C16H13Cl2N3O |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | [2-(2,4-dichloroanilino)-4,5-dihydroimidazol-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCN=C1Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H13Cl2N3O/c17-12-6-7-14(13(18)10-12)20-16-19-8-9-21(16)15(22)11-4-2-1-3-5-11/h1-7,10H,8-9H2,(H,19,20) |
| InChIKey | ITDOODXWMUVAHN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |